C22H19F2N5O3 — CID 11704823
1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[(2-methoxy-3-pyridinyl)amino]methyl]pyrrolo[2,3-c]pyridine-5-carboxamide (PubChem CID 11704823) has the molecular formula C22H19F2N5O3 and a molecular weight of 439.42 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[(2-methoxy-3-pyridinyl)amino]methyl]pyrrolo[2,3-c]pyridine-5-carboxamide.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[(2-methoxy-3-pyridinyl)amino]methyl]pyrrolo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 11704823 |
| Molecular Formula | C22H19F2N5O3 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[(2-methoxy-3-pyridinyl)amino]methyl]pyrrolo[2,3-c]pyridine-5-carboxamide |
| SMILES | COc1ncccc1NCc1cn(Cc2ccc(F)cc2F)c2cnc(C(=O)NO)cc12 |
| InChI | InChI=1S/C22H19F2N5O3/c1-32-22-18(3-2-6-25-22)26-9-14-12-29(11-13-4-5-15(23)7-17(13)24)20-10-27-19(8-16(14)20)21(30)28-31/h2-8,10,12,26,31H,9,11H2,1H3,(H,28,30) |
| InChIKey | DRVFZPDFTZMJFG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|