C20H22F2N4O4 — CID 11575362
1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[2-(2-hydroxyethoxy)ethylamino]methyl]pyrrolo[3,2-c]pyridine-6-carboxamide (PubChem CID 11575362) has the molecular formula C20H22F2N4O4 and a molecular weight of 420.42 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[2-(2-hydroxyethoxy)ethylamino]methyl]pyrrolo[3,2-c]pyridine-6-carboxamide.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[2-(2-hydroxyethoxy)ethylamino]methyl]pyrrolo[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 11575362 |
| Molecular Formula | C20H22F2N4O4 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[2-(2-hydroxyethoxy)ethylamino]methyl]pyrrolo[3,2-c]pyridine-6-carboxamide |
| SMILES | O=C(NO)c1cc2c(cn1)c(CNCCOCCO)cn2Cc1ccc(F)cc1F |
| InChI | InChI=1S/C20H22F2N4O4/c21-15-2-1-13(17(22)7-15)11-26-12-14(9-23-3-5-30-6-4-27)16-10-24-18(8-19(16)26)20(28)25-29/h1-2,7-8,10,12,23,27,29H,3-6,9,11H2,(H,25,28) |
| InChIKey | LJHPJZAPBSHVGF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|