C24H22F2N4O3 — CID 11690985
1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[(2-hydroxy-2-phenylethyl)amino]methyl]pyrrolo[2,3-c]pyridine-5-carboxamide (PubChem CID 11690985) has the molecular formula C24H22F2N4O3 and a molecular weight of 452.46 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[(2-hydroxy-2-phenylethyl)amino]methyl]pyrrolo[2,3-c]pyridine-5-carboxamide.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[(2-hydroxy-2-phenylethyl)amino]methyl]pyrrolo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 11690985 |
| Molecular Formula | C24H22F2N4O3 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-N-hydroxy-3-[[(2-hydroxy-2-phenylethyl)amino]methyl]pyrrolo[2,3-c]pyridine-5-carboxamide |
| SMILES | O=C(NO)c1cc2c(CNCC(O)c3ccccc3)cn(Cc3ccc(F)cc3F)c2cn1 |
| InChI | InChI=1S/C24H22F2N4O3/c25-18-7-6-16(20(26)8-18)13-30-14-17(10-27-12-23(31)15-4-2-1-3-5-15)19-9-21(24(32)29-33)28-11-22(19)30/h1-9,11,14,23,27,31,33H,10,12-13H2,(H,29,32) |
| InChIKey | YCRPESOHKWUZEV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|