C18H18F2N4O2 — CID 86623139
1-[(2,4-difluorophenyl)methyl]-N-methoxy-3-(methylaminomethyl)pyrrolo[2,3-c]pyridine-5-carboxamide (PubChem CID 86623139) has the molecular formula C18H18F2N4O2 and a molecular weight of 360.36 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-N-methoxy-3-(methylaminomethyl)pyrrolo[2,3-c]pyridine-5-carboxamide.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-N-methoxy-3-(methylaminomethyl)pyrrolo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 86623139 |
| Molecular Formula | C18H18F2N4O2 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-N-methoxy-3-(methylaminomethyl)pyrrolo[2,3-c]pyridine-5-carboxamide |
| SMILES | CNCc1cn(Cc2ccc(F)cc2F)c2cnc(C(=O)NOC)cc12 |
| InChI | InChI=1S/C18H18F2N4O2/c1-21-7-12-10-24(9-11-3-4-13(19)5-15(11)20)17-8-22-16(6-14(12)17)18(25)23-26-2/h3-6,8,10,21H,7,9H2,1-2H3,(H,23,25) |
| InChIKey | LRRWLUPSDCEATM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|