C22H23F2N5O3 — CID 11704907
3-[(4-acetylpiperazin-1-yl)methyl]-1-[(2,4-difluorophenyl)methyl]-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide (PubChem CID 11704907) has the molecular formula C22H23F2N5O3 and a molecular weight of 443.45 g/mol. Its IUPAC name is 3-[(4-acetylpiperazin-1-yl)methyl]-1-[(2,4-difluorophenyl)methyl]-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide.
| Compound Name | 3-[(4-acetylpiperazin-1-yl)methyl]-1-[(2,4-difluorophenyl)methyl]-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 11704907 |
| Molecular Formula | C22H23F2N5O3 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 3-[(4-acetylpiperazin-1-yl)methyl]-1-[(2,4-difluorophenyl)methyl]-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide |
| SMILES | CC(=O)N1CCN(Cc2cn(Cc3ccc(F)cc3F)c3cnc(C(=O)NO)cc23)CC1 |
| InChI | InChI=1S/C22H23F2N5O3/c1-14(30)28-6-4-27(5-7-28)11-16-13-29(12-15-2-3-17(23)8-19(15)24)21-10-25-20(9-18(16)21)22(31)26-32/h2-3,8-10,13,32H,4-7,11-12H2,1H3,(H,26,31) |
| InChIKey | DMXHWYHNYFZNDV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|