C22H24FN5O3 — CID 11640453
3-[(3-carbamoylpiperidin-1-yl)methyl]-1-[(4-fluorophenyl)methyl]-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide (PubChem CID 11640453) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is 3-[(3-carbamoylpiperidin-1-yl)methyl]-1-[(4-fluorophenyl)methyl]-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide.
| Compound Name | 3-[(3-carbamoylpiperidin-1-yl)methyl]-1-[(4-fluorophenyl)methyl]-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 11640453 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-[(3-carbamoylpiperidin-1-yl)methyl]-1-[(4-fluorophenyl)methyl]-N-hydroxypyrrolo[2,3-c]pyridine-5-carboxamide |
| SMILES | NC(=O)C1CCCN(Cc2cn(Cc3ccc(F)cc3)c3cnc(C(=O)NO)cc23)C1 |
| InChI | InChI=1S/C22H24FN5O3/c23-17-5-3-14(4-6-17)10-28-13-16(12-27-7-1-2-15(11-27)21(24)29)18-8-19(22(30)26-31)25-9-20(18)28/h3-6,8-9,13,15,31H,1-2,7,10-12H2,(H2,24,29)(H,26,30) |
| InChIKey | FQUFFNCGPNUZGW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|