C24H27FN4O2 — CID 56507013
1-[[4-[[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]phenyl]methyl]piperidine-3-carboxamide (PubChem CID 56507013) has the molecular formula C24H27FN4O2 and a molecular weight of 422.50 g/mol. Its IUPAC name is 1-[[4-[[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]phenyl]methyl]piperidine-3-carboxamide.
| Compound Name | 1-[[4-[[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]phenyl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56507013 |
| Molecular Formula | C24H27FN4O2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-[[4-[[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]phenyl]methyl]piperidine-3-carboxamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)Nc1ccc(CN2CCCC(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C24H27FN4O2/c1-15-20(21-11-18(25)6-9-22(21)27-15)12-23(30)28-19-7-4-16(5-8-19)13-29-10-2-3-17(14-29)24(26)31/h4-9,11,17,27H,2-3,10,12-14H2,1H3,(H2,26,31)(H,28,30) |
| InChIKey | YJDFJOLDFQUXEN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|