C23H24FN3O2 — CID 46474815
N-[4-[1-[[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]ethyl]phenyl]cyclopropanecarboxamide (PubChem CID 46474815) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is N-[4-[1-[[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]ethyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[1-[[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]ethyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46474815 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-[4-[1-[[2-(5-fluoro-2-methyl-1H-indol-3-yl)acetyl]amino]ethyl]phenyl]cyclopropanecarboxamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)NC(C)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C23H24FN3O2/c1-13(15-5-8-18(9-6-15)27-23(29)16-3-4-16)26-22(28)12-19-14(2)25-21-10-7-17(24)11-20(19)21/h5-11,13,16,25H,3-4,12H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | UFSLNQOJHHJNDH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|