About N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide
N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide (PubChem CID 94193646) has the molecular formula C19H20F2N2O
and a molecular weight of 330.38 g/mol. Its IUPAC name is N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide |
| PubChem CID | 94193646 |
| Molecular Formula | C19H20F2N2O |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide |
| SMILES | C[C@@H](NCc1cc(F)ccc1F)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C19H20F2N2O/c1-12(22-11-15-10-16(20)6-9-18(15)21)13-4-7-17(8-5-13)23-19(24)14-2-3-14/h4-10,12,14,22H,2-3,11H2,1H3,(H,23,24)/t12-/m1/s1 |
| InChIKey | GKEGQBZULHSFQH-GFCCVEGCSA-N |
| XLogP | 4.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide?
The IUPAC name of N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide (CID 94193646) is N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide.
What is the SMILES notation for N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide?
The canonical SMILES for N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide is C[C@@H](NCc1cc(F)ccc1F)c1ccc(NC(=O)C2CC2)cc1.
What is the InChIKey of N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide?
The InChIKey is GKEGQBZULHSFQH-GFCCVEGCSA-N. The full InChI is InChI=1S/C19H20F2N2O/c1-12(22-11-15-10-16(20)6-9-18(15)21)13-4-7-17(8-5-13)23-19(24)14-2-3-14/h4-10,12,14,22H,2-3,11H2,1H3,(H,23,24)/t12-/m1/s1.
What are the key properties of N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide?
N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide has a molecular weight of 330.38 g/mol, XLogP of 4.16, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(1R)-1-[(2,5-difluorophenyl)methylamino]ethyl]phenyl]cyclopropanecarboxamide is sourced from PubChem (CID 94193646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).