C20H22N2O3 — CID 122030150
3-[[1-[4-(cyclopropanecarbonylamino)phenyl]ethylamino]methyl]benzoic acid (PubChem CID 122030150) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[[1-[4-(cyclopropanecarbonylamino)phenyl]ethylamino]methyl]benzoic acid.
| Compound Name | 3-[[1-[4-(cyclopropanecarbonylamino)phenyl]ethylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122030150 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-[[1-[4-(cyclopropanecarbonylamino)phenyl]ethylamino]methyl]benzoic acid |
| SMILES | CC(NCc1cccc(C(=O)O)c1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-13(21-12-14-3-2-4-17(11-14)20(24)25)15-7-9-18(10-8-15)22-19(23)16-5-6-16/h2-4,7-11,13,16,21H,5-6,12H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | AZHXWAHLCCVZKT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |