C16H19FN2O2 — CID 31883592
2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide (PubChem CID 31883592) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 31883592 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[[(2R)-oxolan-2-yl]methyl]acetamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C16H19FN2O2/c1-10-13(14-7-11(17)4-5-15(14)19-10)8-16(20)18-9-12-3-2-6-21-12/h4-5,7,12,19H,2-3,6,8-9H2,1H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | OEBXUNNWPVDIMW-GFCCVEGCSA-N |
| XLogP | 2.45 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|