C18H23FN2O2 — CID 111460381
2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(3-hydroxycyclohexyl)methyl]acetamide (PubChem CID 111460381) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(3-hydroxycyclohexyl)methyl]acetamide.
| Compound Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(3-hydroxycyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 111460381 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(3-hydroxycyclohexyl)methyl]acetamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)NCC1CCCC(O)C1 |
| InChI | InChI=1S/C18H23FN2O2/c1-11-15(16-8-13(19)5-6-17(16)21-11)9-18(23)20-10-12-3-2-4-14(22)7-12/h5-6,8,12,14,21-22H,2-4,7,9-10H2,1H3,(H,20,23) |
| InChIKey | HRGNRTYSVFDLIY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|