C17H21FN2O4 — CID 146046730
2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(2R,3S,4S)-3-hydroxy-2-(hydroxymethyl)oxan-4-yl]acetamide (PubChem CID 146046730) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(2R,3S,4S)-3-hydroxy-2-(hydroxymethyl)oxan-4-yl]acetamide.
| Compound Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(2R,3S,4S)-3-hydroxy-2-(hydroxymethyl)oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 146046730 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(2R,3S,4S)-3-hydroxy-2-(hydroxymethyl)oxan-4-yl]acetamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N[C@H]1CCO[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C17H21FN2O4/c1-9-11(12-6-10(18)2-3-13(12)19-9)7-16(22)20-14-4-5-24-15(8-21)17(14)23/h2-3,6,14-15,17,19,21,23H,4-5,7-8H2,1H3,(H,20,22)/t14-,15+,17-/m0/s1 |
| InChIKey | BWFXGSUIQMTHMB-UXLLHSPISA-N |
| XLogP | 0.78 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|