C20H20FN3O — CID 74251445
N-[(1S,2S)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide (PubChem CID 74251445) has the molecular formula C20H20FN3O and a molecular weight of 337.40 g/mol. Its IUPAC name is N-[(1S,2S)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[(1S,2S)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 74251445 |
| Molecular Formula | C20H20FN3O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N-[(1S,2S)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N[C@H]1Cc2ccccc2[C@@H]1N |
| InChI | InChI=1S/C20H20FN3O/c1-11-15(16-9-13(21)6-7-17(16)23-11)10-19(25)24-18-8-12-4-2-3-5-14(12)20(18)22/h2-7,9,18,20,23H,8,10,22H2,1H3,(H,24,25)/t18-,20-/m0/s1 |
| InChIKey | FGVQUTFKMWMKHU-ICSRJNTNSA-N |
| XLogP | 2.90 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|