C17H15F2N3O3 — CID 10405381
3-[(2,4-difluorophenoxy)methyl]-1-ethyl-N-hydroxypyrrolo[3,2-c]pyridine-6-carboxamide (PubChem CID 10405381) has the molecular formula C17H15F2N3O3 and a molecular weight of 347.32 g/mol. Its IUPAC name is 3-[(2,4-difluorophenoxy)methyl]-1-ethyl-N-hydroxypyrrolo[3,2-c]pyridine-6-carboxamide.
| Compound Name | 3-[(2,4-difluorophenoxy)methyl]-1-ethyl-N-hydroxypyrrolo[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 10405381 |
| Molecular Formula | C17H15F2N3O3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 3-[(2,4-difluorophenoxy)methyl]-1-ethyl-N-hydroxypyrrolo[3,2-c]pyridine-6-carboxamide |
| SMILES | CCn1cc(COc2ccc(F)cc2F)c2cnc(C(=O)NO)cc21 |
| InChI | InChI=1S/C17H15F2N3O3/c1-2-22-8-10(9-25-16-4-3-11(18)5-13(16)19)12-7-20-14(6-15(12)22)17(23)21-24/h3-8,24H,2,9H2,1H3,(H,21,23) |
| InChIKey | WOIQPPSUTOOJFL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|