C15H10F3N3O3 — CID 87458709
N-hydroxy-3-[(2,3,4-trifluorophenoxy)methyl]-1H-pyrrolo[3,2-c]pyridine-6-carboxamide (PubChem CID 87458709) has the molecular formula C15H10F3N3O3 and a molecular weight of 337.26 g/mol. Its IUPAC name is N-hydroxy-3-[(2,3,4-trifluorophenoxy)methyl]-1H-pyrrolo[3,2-c]pyridine-6-carboxamide.
| Compound Name | N-hydroxy-3-[(2,3,4-trifluorophenoxy)methyl]-1H-pyrrolo[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 87458709 |
| Molecular Formula | C15H10F3N3O3 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-hydroxy-3-[(2,3,4-trifluorophenoxy)methyl]-1H-pyrrolo[3,2-c]pyridine-6-carboxamide |
| SMILES | O=C(NO)c1cc2[nH]cc(COc3ccc(F)c(F)c3F)c2cn1 |
| InChI | InChI=1S/C15H10F3N3O3/c16-9-1-2-12(14(18)13(9)17)24-6-7-4-19-10-3-11(15(22)21-23)20-5-8(7)10/h1-5,19,23H,6H2,(H,21,22) |
| InChIKey | DPWIZHPUYSFLRE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|