C17H14F3N3O3 — CID 10090221
1-ethyl-N-hydroxy-3-[(3,4,5-trifluoro-2-hydroxyphenyl)methyl]pyrrolo[3,2-c]pyridine-6-carboxamide (PubChem CID 10090221) has the molecular formula C17H14F3N3O3 and a molecular weight of 365.31 g/mol. Its IUPAC name is 1-ethyl-N-hydroxy-3-[(3,4,5-trifluoro-2-hydroxyphenyl)methyl]pyrrolo[3,2-c]pyridine-6-carboxamide.
| Compound Name | 1-ethyl-N-hydroxy-3-[(3,4,5-trifluoro-2-hydroxyphenyl)methyl]pyrrolo[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 10090221 |
| Molecular Formula | C17H14F3N3O3 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-ethyl-N-hydroxy-3-[(3,4,5-trifluoro-2-hydroxyphenyl)methyl]pyrrolo[3,2-c]pyridine-6-carboxamide |
| SMILES | CCn1cc(Cc2cc(F)c(F)c(F)c2O)c2cnc(C(=O)NO)cc21 |
| InChI | InChI=1S/C17H14F3N3O3/c1-2-23-7-9(3-8-4-11(18)14(19)15(20)16(8)24)10-6-21-12(5-13(10)23)17(25)22-26/h4-7,24,26H,2-3H2,1H3,(H,22,25) |
| InChIKey | JSQHVEIJSAPFNR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|