C10H11N3O2 — CID 174758035
(3-ethyl-1H-pyrrolo[3,2-c]pyridin-6-yl)carbamic acid (PubChem CID 174758035) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is (3-ethyl-1H-pyrrolo[3,2-c]pyridin-6-yl)carbamic acid.
| Compound Name | (3-ethyl-1H-pyrrolo[3,2-c]pyridin-6-yl)carbamic acid |
|---|---|
| PubChem CID | 174758035 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (3-ethyl-1H-pyrrolo[3,2-c]pyridin-6-yl)carbamic acid |
| SMILES | CCc1c[nH]c2cc(NC(=O)O)ncc12 |
| InChI | InChI=1S/C10H11N3O2/c1-2-6-4-11-8-3-9(13-10(14)15)12-5-7(6)8/h3-5,11H,2H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | BMFUBUNVAUBAPD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |