pyrido[3,4-b]pyrazin-7-ylcarbamic acid

C8H6N4O2 — CID 149253960

IUPACpyrido[3,4-b]pyrazin-7-ylcarbamic acid
SMILESO=C(O)Nc1cc2nccnc2cn1
InChIInChI=1S/C8H6N4O2/c13-8(14)12-7-3-5-6(4-11-7)10-2-1-9-5/h1-4H,(H,11,12)(H,13,14)
InChIKeyXWQXKHFCOBEDKZ-UHFFFAOYSA-N
MW190.16 g/mol
LogP1.11
Rot. Bonds1

About pyrido[3,4-b]pyrazin-7-ylcarbamic acid

pyrido[3,4-b]pyrazin-7-ylcarbamic acid (PubChem CID 149253960) has the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. Its IUPAC name is pyrido[3,4-b]pyrazin-7-ylcarbamic acid.

Molecular Properties

Compound Namepyrido[3,4-b]pyrazin-7-ylcarbamic acid
PubChem CID149253960
Molecular FormulaC8H6N4O2
Molecular Weight190.16 g/mol
Exact Mass190.05
IUPAC Namepyrido[3,4-b]pyrazin-7-ylcarbamic acid
SMILESO=C(O)Nc1cc2nccnc2cn1
InChIInChI=1S/C8H6N4O2/c13-8(14)12-7-3-5-6(4-11-7)10-2-1-9-5/h1-4H,(H,11,12)(H,13,14)
InChIKeyXWQXKHFCOBEDKZ-UHFFFAOYSA-N
XLogP1.11
TPSA88.00 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.16
LogP ≤ 51.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze pyrido[3,4-b]pyrazin-7-ylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyrido[3,4-b]pyrazin-7-ylcarbamic acid?
The IUPAC name of pyrido[3,4-b]pyrazin-7-ylcarbamic acid (CID 149253960) is pyrido[3,4-b]pyrazin-7-ylcarbamic acid.
What is the SMILES notation for pyrido[3,4-b]pyrazin-7-ylcarbamic acid?
The canonical SMILES for pyrido[3,4-b]pyrazin-7-ylcarbamic acid is O=C(O)Nc1cc2nccnc2cn1.
What is the InChIKey of pyrido[3,4-b]pyrazin-7-ylcarbamic acid?
The InChIKey is XWQXKHFCOBEDKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O2/c13-8(14)12-7-3-5-6(4-11-7)10-2-1-9-5/h1-4H,(H,11,12)(H,13,14).
What are the key properties of pyrido[3,4-b]pyrazin-7-ylcarbamic acid?
pyrido[3,4-b]pyrazin-7-ylcarbamic acid has a molecular weight of 190.16 g/mol, XLogP of 1.11, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[3,4-b]pyrazin-7-ylcarbamic acid is sourced from PubChem (CID 149253960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).