C8H6N4O2 — CID 149253960
pyrido[3,4-b]pyrazin-7-ylcarbamic acid (PubChem CID 149253960) has the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. Its IUPAC name is pyrido[3,4-b]pyrazin-7-ylcarbamic acid.
| Compound Name | pyrido[3,4-b]pyrazin-7-ylcarbamic acid |
|---|---|
| PubChem CID | 149253960 |
| Molecular Formula | C8H6N4O2 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | pyrido[3,4-b]pyrazin-7-ylcarbamic acid |
| SMILES | O=C(O)Nc1cc2nccnc2cn1 |
| InChI | InChI=1S/C8H6N4O2/c13-8(14)12-7-3-5-6(4-11-7)10-2-1-9-5/h1-4H,(H,11,12)(H,13,14) |
| InChIKey | XWQXKHFCOBEDKZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |