C7H9N3O2 — CID 154255839
[4-(aminomethyl)-2-pyridinyl]carbamic acid (PubChem CID 154255839) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is [4-(aminomethyl)-2-pyridinyl]carbamic acid.
| Compound Name | [4-(aminomethyl)-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 154255839 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | [4-(aminomethyl)-2-pyridinyl]carbamic acid |
| SMILES | NCc1ccnc(NC(=O)O)c1 |
| InChI | InChI=1S/C7H9N3O2/c8-4-5-1-2-9-6(3-5)10-7(11)12/h1-3H,4,8H2,(H,9,10)(H,11,12) |
| InChIKey | AXJJYTWHACBVFR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |