C19H19ClN4O2 — CID 171504992
N-[4-(aminomethyl)-2-pyridinyl]-3-phenylmethoxypyridine-2-carboxamide;hydrochloride (PubChem CID 171504992) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is N-[4-(aminomethyl)-2-pyridinyl]-3-phenylmethoxypyridine-2-carboxamide;hydrochloride.
| Compound Name | N-[4-(aminomethyl)-2-pyridinyl]-3-phenylmethoxypyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 171504992 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[4-(aminomethyl)-2-pyridinyl]-3-phenylmethoxypyridine-2-carboxamide;hydrochloride |
| SMILES | Cl.NCc1ccnc(NC(=O)c2ncccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H18N4O2.ClH/c20-12-15-8-10-21-17(11-15)23-19(24)18-16(7-4-9-22-18)25-13-14-5-2-1-3-6-14;/h1-11H,12-13,20H2,(H,21,23,24);1H |
| InChIKey | QRNVWIWZSKSADG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |