About 3-ethyl-1H-indol-6-amine;N-methylformamide
3-ethyl-1H-indol-6-amine;N-methylformamide (PubChem CID 155742399) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-ethyl-1H-indol-6-amine;N-methylformamide.
Molecular Properties
| Compound Name | 3-ethyl-1H-indol-6-amine;N-methylformamide |
| PubChem CID | 155742399 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 3-ethyl-1H-indol-6-amine;N-methylformamide |
| SMILES | CCc1c[nH]c2cc(N)ccc12.CNC=O |
| InChI | InChI=1S/C10H12N2.C2H5NO/c1-2-7-6-12-10-5-8(11)3-4-9(7)10;1-3-2-4/h3-6,12H,2,11H2,1H3;2H,1H3,(H,3,4) |
| InChIKey | UFYYCXKTLWMMPU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1H-indol-6-amine;N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1H-indol-6-amine;N-methylformamide?
The IUPAC name of 3-ethyl-1H-indol-6-amine;N-methylformamide (CID 155742399) is 3-ethyl-1H-indol-6-amine;N-methylformamide.
What is the SMILES notation for 3-ethyl-1H-indol-6-amine;N-methylformamide?
The canonical SMILES for 3-ethyl-1H-indol-6-amine;N-methylformamide is CCc1c[nH]c2cc(N)ccc12.CNC=O.
What is the InChIKey of 3-ethyl-1H-indol-6-amine;N-methylformamide?
The InChIKey is UFYYCXKTLWMMPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2.C2H5NO/c1-2-7-6-12-10-5-8(11)3-4-9(7)10;1-3-2-4/h3-6,12H,2,11H2,1H3;2H,1H3,(H,3,4).
What are the key properties of 3-ethyl-1H-indol-6-amine;N-methylformamide?
3-ethyl-1H-indol-6-amine;N-methylformamide has a molecular weight of 219.29 g/mol, XLogP of 1.67, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1H-indol-6-amine;N-methylformamide is sourced from PubChem (CID 155742399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).