C11H13N3O — CID 155392040
2-(6-amino-1H-indol-3-yl)-N-methylacetamide (PubChem CID 155392040) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-(6-amino-1H-indol-3-yl)-N-methylacetamide.
| Compound Name | 2-(6-amino-1H-indol-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 155392040 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-(6-amino-1H-indol-3-yl)-N-methylacetamide |
| SMILES | CNC(=O)Cc1c[nH]c2cc(N)ccc12 |
| InChI | InChI=1S/C11H13N3O/c1-13-11(15)4-7-6-14-10-5-8(12)2-3-9(7)10/h2-3,5-6,14H,4,12H2,1H3,(H,13,15) |
| InChIKey | LQFKYYLRBLDMQJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|