About 3-ethyl-6-iodo-1H-indole
3-ethyl-6-iodo-1H-indole (PubChem CID 135269455) has the molecular formula C10H10IN
and a molecular weight of 271.10 g/mol. Its IUPAC name is 3-ethyl-6-iodo-1H-indole.
Molecular Properties
| Compound Name | 3-ethyl-6-iodo-1H-indole |
| PubChem CID | 135269455 |
| Molecular Formula | C10H10IN |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 3-ethyl-6-iodo-1H-indole |
| SMILES | CCc1c[nH]c2cc(I)ccc12 |
| InChI | InChI=1S/C10H10IN/c1-2-7-6-12-10-5-8(11)3-4-9(7)10/h3-6,12H,2H2,1H3 |
| InChIKey | JXBPUSQDAOHBMT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-6-iodo-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-iodo-1H-indole?
The IUPAC name of 3-ethyl-6-iodo-1H-indole (CID 135269455) is 3-ethyl-6-iodo-1H-indole.
What is the SMILES notation for 3-ethyl-6-iodo-1H-indole?
The canonical SMILES for 3-ethyl-6-iodo-1H-indole is CCc1c[nH]c2cc(I)ccc12.
What is the InChIKey of 3-ethyl-6-iodo-1H-indole?
The InChIKey is JXBPUSQDAOHBMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10IN/c1-2-7-6-12-10-5-8(11)3-4-9(7)10/h3-6,12H,2H2,1H3.
What are the key properties of 3-ethyl-6-iodo-1H-indole?
3-ethyl-6-iodo-1H-indole has a molecular weight of 271.10 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-iodo-1H-indole is sourced from PubChem (CID 135269455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).