C13H17IN2 — CID 90144904
(2R)-1-(6-iodo-1H-indol-3-yl)-N,N-dimethylpropan-2-amine (PubChem CID 90144904) has the molecular formula C13H17IN2 and a molecular weight of 328.20 g/mol. Its IUPAC name is (2R)-1-(6-iodo-1H-indol-3-yl)-N,N-dimethylpropan-2-amine.
| Compound Name | (2R)-1-(6-iodo-1H-indol-3-yl)-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 90144904 |
| Molecular Formula | C13H17IN2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | (2R)-1-(6-iodo-1H-indol-3-yl)-N,N-dimethylpropan-2-amine |
| SMILES | C[C@H](Cc1c[nH]c2cc(I)ccc12)N(C)C |
| InChI | InChI=1S/C13H17IN2/c1-9(16(2)3)6-10-8-15-13-7-11(14)4-5-12(10)13/h4-5,7-9,15H,6H2,1-3H3/t9-/m1/s1 |
| InChIKey | FCEBHOXUTLJORA-SECBINFHSA-N |
| XLogP | 3.27 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|