C24H29F2N3O2 — CID 153365983
2-(dimethylamino)-3-(6-fluoro-1H-indol-3-yl)propanal;2-(dimethylamino)-3-(4-fluorophenyl)propanal (PubChem CID 153365983) has the molecular formula C24H29F2N3O2 and a molecular weight of 429.51 g/mol. Its IUPAC name is 2-(dimethylamino)-3-(6-fluoro-1H-indol-3-yl)propanal;2-(dimethylamino)-3-(4-fluorophenyl)propanal.
| Compound Name | 2-(dimethylamino)-3-(6-fluoro-1H-indol-3-yl)propanal;2-(dimethylamino)-3-(4-fluorophenyl)propanal |
|---|---|
| PubChem CID | 153365983 |
| Molecular Formula | C24H29F2N3O2 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-(dimethylamino)-3-(6-fluoro-1H-indol-3-yl)propanal;2-(dimethylamino)-3-(4-fluorophenyl)propanal |
| SMILES | CN(C)C(C=O)Cc1c[nH]c2cc(F)ccc12.CN(C)C(C=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN2O.C11H14FNO/c1-16(2)11(8-17)5-9-7-15-13-6-10(14)3-4-12(9)13;1-13(2)11(8-14)7-9-3-5-10(12)6-4-9/h3-4,6-8,11,15H,5H2,1-2H3;3-6,8,11H,7H2,1-2H3 |
| InChIKey | LJNUPNXYEASJEF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|