C12H18BrFN2O — CID 145225925
2-amino-4-(6-fluoro-1H-indol-3-yl)butanal;molecular hydrogen;hydrobromide (PubChem CID 145225925) has the molecular formula C12H18BrFN2O and a molecular weight of 305.19 g/mol. Its IUPAC name is 2-amino-4-(6-fluoro-1H-indol-3-yl)butanal;molecular hydrogen;hydrobromide.
| Compound Name | 2-amino-4-(6-fluoro-1H-indol-3-yl)butanal;molecular hydrogen;hydrobromide |
|---|---|
| PubChem CID | 145225925 |
| Molecular Formula | C12H18BrFN2O |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-amino-4-(6-fluoro-1H-indol-3-yl)butanal;molecular hydrogen;hydrobromide |
| SMILES | Br.NC(C=O)CCc1c[nH]c2cc(F)ccc12.[H][H].[H][H] |
| InChI | InChI=1S/C12H13FN2O.BrH.2H2/c13-9-2-4-11-8(1-3-10(14)7-16)6-15-12(11)5-9;;;/h2,4-7,10,15H,1,3,14H2;3*1H |
| InChIKey | SDUBEHLLLWEVPZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|