About 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide
1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide (PubChem CID 23623089) has the molecular formula C15H21BrN2O
and a molecular weight of 325.25 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide.
Molecular Properties
| Compound Name | 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide |
| PubChem CID | 23623089 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide |
| SMILES | Br.C#CCN(C)C(C)Cc1c[nH]c2ccccc12.O |
| InChI | InChI=1S/C15H18N2.BrH.H2O/c1-4-9-17(3)12(2)10-13-11-16-15-8-6-5-7-14(13)15;;/h1,5-8,11-12,16H,9-10H2,2-3H3;1H;1H2 |
| InChIKey | QUAVVFMILFBUHK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide?
The IUPAC name of 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide (CID 23623089) is 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide.
What is the SMILES notation for 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide?
The canonical SMILES for 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide is Br.C#CCN(C)C(C)Cc1c[nH]c2ccccc12.O.
What is the InChIKey of 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide?
The InChIKey is QUAVVFMILFBUHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2.BrH.H2O/c1-4-9-17(3)12(2)10-13-11-16-15-8-6-5-7-14(13)15;;/h1,5-8,11-12,16H,9-10H2,2-3H3;1H;1H2.
What are the key properties of 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide?
1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide has a molecular weight of 325.25 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-indol-3-yl)-N-methyl-N-prop-2-ynylpropan-2-amine;hydrate;hydrobromide is sourced from PubChem (CID 23623089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).