C14H21N — CID 145378179
3-[(2R)-2,3-dimethylbut-3-enyl]-1H-indole;molecular hydrogen (PubChem CID 145378179) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 3-[(2R)-2,3-dimethylbut-3-enyl]-1H-indole;molecular hydrogen.
| Compound Name | 3-[(2R)-2,3-dimethylbut-3-enyl]-1H-indole;molecular hydrogen |
|---|---|
| PubChem CID | 145378179 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 3-[(2R)-2,3-dimethylbut-3-enyl]-1H-indole;molecular hydrogen |
| SMILES | C=C(C)[C@H](C)Cc1c[nH]c2ccccc12.[H][H].[H][H] |
| InChI | InChI=1S/C14H17N.2H2/c1-10(2)11(3)8-12-9-15-14-7-5-4-6-13(12)14;;/h4-7,9,11,15H,1,8H2,2-3H3;2*1H/t11-;;/m1../s1 |
| InChIKey | CEHBUVZMMWKEIP-NVJADKKVSA-N |
| XLogP | 4.41 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|