C16H22N2 — CID 138643387
N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]-2-methylidenebutan-1-amine (PubChem CID 138643387) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]-2-methylidenebutan-1-amine.
| Compound Name | N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]-2-methylidenebutan-1-amine |
|---|---|
| PubChem CID | 138643387 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]-2-methylidenebutan-1-amine |
| SMILES | C=C(CC)CN[C@H](C)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H22N2/c1-4-12(2)10-17-13(3)9-14-11-18-16-8-6-5-7-15(14)16/h5-8,11,13,17-18H,2,4,9-10H2,1,3H3/t13-/m1/s1 |
| InChIKey | PRPMRAPAODOWRF-CYBMUJFWSA-N |
| XLogP | 3.65 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|