C13H15N3 — CID 115130271
2-[1H-indol-3-ylmethyl(methyl)amino]propanenitrile (PubChem CID 115130271) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[1H-indol-3-ylmethyl(methyl)amino]propanenitrile.
| Compound Name | 2-[1H-indol-3-ylmethyl(methyl)amino]propanenitrile |
|---|---|
| PubChem CID | 115130271 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-[1H-indol-3-ylmethyl(methyl)amino]propanenitrile |
| SMILES | CC(C#N)N(C)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H15N3/c1-10(7-14)16(2)9-11-8-15-13-6-4-3-5-12(11)13/h3-6,8,10,15H,9H2,1-2H3 |
| InChIKey | LYAVNIQADIQGAN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |