C17H26N2 — CID 156849664
N-(1H-indol-3-ylmethyl)-3-methyl-N-propan-2-ylbutan-1-amine (PubChem CID 156849664) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N-(1H-indol-3-ylmethyl)-3-methyl-N-propan-2-ylbutan-1-amine.
| Compound Name | N-(1H-indol-3-ylmethyl)-3-methyl-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 156849664 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N-(1H-indol-3-ylmethyl)-3-methyl-N-propan-2-ylbutan-1-amine |
| SMILES | CC(C)CCN(Cc1c[nH]c2ccccc12)C(C)C |
| InChI | InChI=1S/C17H26N2/c1-13(2)9-10-19(14(3)4)12-15-11-18-17-8-6-5-7-16(15)17/h5-8,11,13-14,18H,9-10,12H2,1-4H3 |
| InChIKey | KRKRPNCOUQSWNQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |