C14H19N — CID 129190941
3-(2,2-dimethylpropyl)-6-methyl-1H-indole (PubChem CID 129190941) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-6-methyl-1H-indole.
| Compound Name | 3-(2,2-dimethylpropyl)-6-methyl-1H-indole |
|---|---|
| PubChem CID | 129190941 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-6-methyl-1H-indole |
| SMILES | Cc1ccc2c(CC(C)(C)C)c[nH]c2c1 |
| InChI | InChI=1S/C14H19N/c1-10-5-6-12-11(8-14(2,3)4)9-15-13(12)7-10/h5-7,9,15H,8H2,1-4H3 |
| InChIKey | OWLDSVVFKKIFRN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |