C17H15ClF3N — CID 175085793
6-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]-1H-indole;hydrochloride (PubChem CID 175085793) has the molecular formula C17H15ClF3N and a molecular weight of 325.76 g/mol. Its IUPAC name is 6-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]-1H-indole;hydrochloride.
| Compound Name | 6-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]-1H-indole;hydrochloride |
|---|---|
| PubChem CID | 175085793 |
| Molecular Formula | C17H15ClF3N |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 6-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]-1H-indole;hydrochloride |
| SMILES | Cc1ccc2c(Cc3ccc(C(F)(F)F)cc3)c[nH]c2c1.Cl |
| InChI | InChI=1S/C17H14F3N.ClH/c1-11-2-7-15-13(10-21-16(15)8-11)9-12-3-5-14(6-4-12)17(18,19)20;/h2-8,10,21H,9H2,1H3;1H |
| InChIKey | YFWIYENRNYUQMS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |