C15H13F3S — CID 67458019
2-[(4-methylphenyl)methyl]-5-(trifluoromethyl)benzenethiol (PubChem CID 67458019) has the molecular formula C15H13F3S and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl]-5-(trifluoromethyl)benzenethiol.
| Compound Name | 2-[(4-methylphenyl)methyl]-5-(trifluoromethyl)benzenethiol |
|---|---|
| PubChem CID | 67458019 |
| Molecular Formula | C15H13F3S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-[(4-methylphenyl)methyl]-5-(trifluoromethyl)benzenethiol |
| SMILES | Cc1ccc(Cc2ccc(C(F)(F)F)cc2S)cc1 |
| InChI | InChI=1S/C15H13F3S/c1-10-2-4-11(5-3-10)8-12-6-7-13(9-14(12)19)15(16,17)18/h2-7,9,19H,8H2,1H3 |
| InChIKey | FKFIAMMLHUGHKG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|