C19H18F3NO3 — CID 134832559
6-(trifluoromethyl)-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole (PubChem CID 134832559) has the molecular formula C19H18F3NO3 and a molecular weight of 365.35 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole.
| Compound Name | 6-(trifluoromethyl)-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole |
|---|---|
| PubChem CID | 134832559 |
| Molecular Formula | C19H18F3NO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 6-(trifluoromethyl)-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole |
| SMILES | COc1cc(Cc2c[nH]c3cc(C(F)(F)F)ccc23)cc(OC)c1OC |
| InChI | InChI=1S/C19H18F3NO3/c1-24-16-7-11(8-17(25-2)18(16)26-3)6-12-10-23-15-9-13(19(20,21)22)4-5-14(12)15/h4-5,7-10,23H,6H2,1-3H3 |
| InChIKey | OEEROSSATUQEBM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |