C13H18N4O2 — CID 82569866
1-N-(2-aminoethyl)-5,6-dimethoxyisoquinoline-1,8-diamine (PubChem CID 82569866) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-5,6-dimethoxyisoquinoline-1,8-diamine.
| Compound Name | 1-N-(2-aminoethyl)-5,6-dimethoxyisoquinoline-1,8-diamine |
|---|---|
| PubChem CID | 82569866 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-N-(2-aminoethyl)-5,6-dimethoxyisoquinoline-1,8-diamine |
| SMILES | COc1cc(N)c2c(NCCN)nccc2c1OC |
| InChI | InChI=1S/C13H18N4O2/c1-18-10-7-9(15)11-8(12(10)19-2)3-5-16-13(11)17-6-4-14/h3,5,7H,4,6,14-15H2,1-2H3,(H,16,17) |
| InChIKey | WYRHTXAFEPZVNJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|