C13H17N3O2 — CID 82569860
1-N-ethyl-5,6-dimethoxyisoquinoline-1,8-diamine (PubChem CID 82569860) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-N-ethyl-5,6-dimethoxyisoquinoline-1,8-diamine.
| Compound Name | 1-N-ethyl-5,6-dimethoxyisoquinoline-1,8-diamine |
|---|---|
| PubChem CID | 82569860 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-N-ethyl-5,6-dimethoxyisoquinoline-1,8-diamine |
| SMILES | CCNc1nccc2c(OC)c(OC)cc(N)c12 |
| InChI | InChI=1S/C13H17N3O2/c1-4-15-13-11-8(5-6-16-13)12(18-3)10(17-2)7-9(11)14/h5-7H,4,14H2,1-3H3,(H,15,16) |
| InChIKey | WZGAOCSHJUHRQY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|