C11H13N3 — CID 82569868
1-N-ethylisoquinoline-1,8-diamine (PubChem CID 82569868) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 1-N-ethylisoquinoline-1,8-diamine.
| Compound Name | 1-N-ethylisoquinoline-1,8-diamine |
|---|---|
| PubChem CID | 82569868 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1-N-ethylisoquinoline-1,8-diamine |
| SMILES | CCNc1nccc2cccc(N)c12 |
| InChI | InChI=1S/C11H13N3/c1-2-13-11-10-8(6-7-14-11)4-3-5-9(10)12/h3-7H,2,12H2,1H3,(H,13,14) |
| InChIKey | IKHZPOFSDMPYLH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|