C21H21NO6 — CID 139055544
6,7,8,11,12,13-hexamethoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene (PubChem CID 139055544) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is 6,7,8,11,12,13-hexamethoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene.
| Compound Name | 6,7,8,11,12,13-hexamethoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene |
|---|---|
| PubChem CID | 139055544 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 6,7,8,11,12,13-hexamethoxy-2-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(OC)c(OC)c(OC)c3ccnc-2c13 |
| InChI | InChI=1S/C21H21NO6/c1-23-12-9-11-14(19(26-4)18(12)25-3)15-13-10(7-8-22-16(11)13)17(24-2)21(28-6)20(15)27-5/h7-9H,1-6H3 |
| InChIKey | QHHBTIHUAGZLEI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |