C24H20N2O5 — CID 15696656
5,6-dimethoxy-1-(2-nitrophenyl)-8-phenylmethoxyisoquinoline (PubChem CID 15696656) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is 5,6-dimethoxy-1-(2-nitrophenyl)-8-phenylmethoxyisoquinoline.
| Compound Name | 5,6-dimethoxy-1-(2-nitrophenyl)-8-phenylmethoxyisoquinoline |
|---|---|
| PubChem CID | 15696656 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 5,6-dimethoxy-1-(2-nitrophenyl)-8-phenylmethoxyisoquinoline |
| SMILES | COc1cc(OCc2ccccc2)c2c(-c3ccccc3[N+](=O)[O-])nccc2c1OC |
| InChI | InChI=1S/C24H20N2O5/c1-29-21-14-20(31-15-16-8-4-3-5-9-16)22-18(24(21)30-2)12-13-25-23(22)17-10-6-7-11-19(17)26(27)28/h3-14H,15H2,1-2H3 |
| InChIKey | ZATKXWBVUKEDHK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|