C19H19N3O4 — CID 110535624
1-ethyl-2-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)imidazole (PubChem CID 110535624) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-ethyl-2-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)imidazole.
| Compound Name | 1-ethyl-2-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)imidazole |
|---|---|
| PubChem CID | 110535624 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-ethyl-2-(3-methoxy-5-nitro-4-phenylmethoxyphenyl)imidazole |
| SMILES | CCn1ccnc1-c1cc(OC)c(OCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N3O4/c1-3-21-10-9-20-19(21)15-11-16(22(23)24)18(17(12-15)25-2)26-13-14-7-5-4-6-8-14/h4-12H,3,13H2,1-2H3 |
| InChIKey | JCVIWBUSGRFKSD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|