C27H27N5O5 — CID 46203245
3-(4-methylpiperazin-1-yl)-5-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-1,2,4-oxadiazole (PubChem CID 46203245) has the molecular formula C27H27N5O5 and a molecular weight of 501.54 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-5-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-1,2,4-oxadiazole.
| Compound Name | 3-(4-methylpiperazin-1-yl)-5-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46203245 |
| Molecular Formula | C27H27N5O5 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-5-[3-nitro-4,5-bis(phenylmethoxy)phenyl]-1,2,4-oxadiazole |
| SMILES | CN1CCN(c2noc(-c3cc(OCc4ccccc4)c(OCc4ccccc4)c([N+](=O)[O-])c3)n2)CC1 |
| InChI | InChI=1S/C27H27N5O5/c1-30-12-14-31(15-13-30)27-28-26(37-29-27)22-16-23(32(33)34)25(36-19-21-10-6-3-7-11-21)24(17-22)35-18-20-8-4-2-5-9-20/h2-11,16-17H,12-15,18-19H2,1H3 |
| InChIKey | FVUWZHOWJCOCCR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 107.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|