C18H17N3O6 — CID 142496914
5-(3,4-dimethoxy-5-nitrophenyl)-3-[(3-methoxyphenyl)methyl]-1,2,4-oxadiazole (PubChem CID 142496914) has the molecular formula C18H17N3O6 and a molecular weight of 371.35 g/mol. Its IUPAC name is 5-(3,4-dimethoxy-5-nitrophenyl)-3-[(3-methoxyphenyl)methyl]-1,2,4-oxadiazole.
| Compound Name | 5-(3,4-dimethoxy-5-nitrophenyl)-3-[(3-methoxyphenyl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 142496914 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 5-(3,4-dimethoxy-5-nitrophenyl)-3-[(3-methoxyphenyl)methyl]-1,2,4-oxadiazole |
| SMILES | COc1cccc(Cc2noc(-c3cc(OC)c(OC)c([N+](=O)[O-])c3)n2)c1 |
| InChI | InChI=1S/C18H17N3O6/c1-24-13-6-4-5-11(7-13)8-16-19-18(27-20-16)12-9-14(21(22)23)17(26-3)15(10-12)25-2/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | VYGIUOAFOSNVIG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 109.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|