C34H27N5O9 — CID 139594016
3-[[4-[5,7-dinitro-2-(3,4,5-trimethoxyphenyl)quinolin-3-yl]phenoxy]methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole (PubChem CID 139594016) has the molecular formula C34H27N5O9 and a molecular weight of 649.62 g/mol. Its IUPAC name is 3-[[4-[5,7-dinitro-2-(3,4,5-trimethoxyphenyl)quinolin-3-yl]phenoxy]methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-[[4-[5,7-dinitro-2-(3,4,5-trimethoxyphenyl)quinolin-3-yl]phenoxy]methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 139594016 |
| Molecular Formula | C34H27N5O9 |
| Molecular Weight | 649.62 g/mol |
| Exact Mass | 649.18 |
| IUPAC Name | 3-[[4-[5,7-dinitro-2-(3,4,5-trimethoxyphenyl)quinolin-3-yl]phenoxy]methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole |
| SMILES | COc1cc(-c2nc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3cc2-c2ccc(OCc3noc(-c4ccc(C)cc4)n3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C34H27N5O9/c1-19-5-7-21(8-6-19)34-36-31(37-48-34)18-47-24-11-9-20(10-12-24)25-17-26-27(15-23(38(40)41)16-28(26)39(42)43)35-32(25)22-13-29(44-2)33(46-4)30(14-22)45-3/h5-17H,18H2,1-4H3 |
| InChIKey | IFIKDMLPVOGORV-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 175.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.62 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|