C15H11N3O7 — CID 142496898
5-[3-[(3,4-dihydroxyphenyl)methyl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol (PubChem CID 142496898) has the molecular formula C15H11N3O7 and a molecular weight of 345.27 g/mol. Its IUPAC name is 5-[3-[(3,4-dihydroxyphenyl)methyl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[3-[(3,4-dihydroxyphenyl)methyl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 142496898 |
| Molecular Formula | C15H11N3O7 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 5-[3-[(3,4-dihydroxyphenyl)methyl]-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(-c2nc(Cc3ccc(O)c(O)c3)no2)cc(O)c1O |
| InChI | InChI=1S/C15H11N3O7/c19-10-2-1-7(3-11(10)20)4-13-16-15(25-17-13)8-5-9(18(23)24)14(22)12(21)6-8/h1-3,5-6,19-22H,4H2 |
| InChIKey | QEOCHKHLFOTVSR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|