C16H12BrN3O8 — CID 142496716
4-bromo-5-[2-[5-(3,4-dihydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethyl]benzene-1,2,3-triol (PubChem CID 142496716) has the molecular formula C16H12BrN3O8 and a molecular weight of 454.19 g/mol. Its IUPAC name is 4-bromo-5-[2-[5-(3,4-dihydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethyl]benzene-1,2,3-triol.
| Compound Name | 4-bromo-5-[2-[5-(3,4-dihydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 142496716 |
| Molecular Formula | C16H12BrN3O8 |
| Molecular Weight | 454.19 g/mol |
| Exact Mass | 452.98 |
| IUPAC Name | 4-bromo-5-[2-[5-(3,4-dihydroxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]ethyl]benzene-1,2,3-triol |
| SMILES | O=[N+]([O-])c1cc(-c2nc(CCc3cc(O)c(O)c(O)c3Br)no2)cc(O)c1O |
| InChI | InChI=1S/C16H12BrN3O8/c17-12-6(4-10(22)14(24)15(12)25)1-2-11-18-16(28-19-11)7-3-8(20(26)27)13(23)9(21)5-7/h3-5,21-25H,1-2H2 |
| InChIKey | DGAOPAGCCIJWFI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|