C15H10BrClN4O7 — CID 136627482
5-[3-(2-bromo-5-chloro-4,6-dimethoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol (PubChem CID 136627482) has the molecular formula C15H10BrClN4O7 and a molecular weight of 473.62 g/mol. Its IUPAC name is 5-[3-(2-bromo-5-chloro-4,6-dimethoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[3-(2-bromo-5-chloro-4,6-dimethoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 136627482 |
| Molecular Formula | C15H10BrClN4O7 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 471.94 |
| IUPAC Name | 5-[3-(2-bromo-5-chloro-4,6-dimethoxy-3-pyridinyl)-1,2,4-oxadiazol-5-yl]-3-nitrobenzene-1,2-diol |
| SMILES | COc1nc(Br)c(-c2noc(-c3cc(O)c(O)c([N+](=O)[O-])c3)n2)c(OC)c1Cl |
| InChI | InChI=1S/C15H10BrClN4O7/c1-26-11-8(12(16)18-15(27-2)9(11)17)13-19-14(28-20-13)5-3-6(21(24)25)10(23)7(22)4-5/h3-4,22-23H,1-2H3 |
| InChIKey | IBIGMGQAOVAFLY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 153.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|