C16H12ClN3O5 — CID 23008260
5-(4-chloro-3-nitrophenyl)-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 23008260) has the molecular formula C16H12ClN3O5 and a molecular weight of 361.74 g/mol. Its IUPAC name is 5-(4-chloro-3-nitrophenyl)-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(4-chloro-3-nitrophenyl)-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 23008260 |
| Molecular Formula | C16H12ClN3O5 |
| Molecular Weight | 361.74 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 5-(4-chloro-3-nitrophenyl)-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1cccc(-c2noc(-c3ccc(Cl)c([N+](=O)[O-])c3)n2)c1OC |
| InChI | InChI=1S/C16H12ClN3O5/c1-23-13-5-3-4-10(14(13)24-2)15-18-16(25-19-15)9-6-7-11(17)12(8-9)20(21)22/h3-8H,1-2H3 |
| InChIKey | KGNWIXJGNYKJRF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 100.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|