C18H13ClN4O6 — CID 142496912
4-[5-(2-chloro-3,4-dimethoxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-2-methoxybenzonitrile (PubChem CID 142496912) has the molecular formula C18H13ClN4O6 and a molecular weight of 416.78 g/mol. Its IUPAC name is 4-[5-(2-chloro-3,4-dimethoxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-2-methoxybenzonitrile.
| Compound Name | 4-[5-(2-chloro-3,4-dimethoxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 142496912 |
| Molecular Formula | C18H13ClN4O6 |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 4-[5-(2-chloro-3,4-dimethoxy-5-nitrophenyl)-1,2,4-oxadiazol-3-yl]-2-methoxybenzonitrile |
| SMILES | COc1cc(-c2noc(-c3cc([N+](=O)[O-])c(OC)c(OC)c3Cl)n2)ccc1C#N |
| InChI | InChI=1S/C18H13ClN4O6/c1-26-13-6-9(4-5-10(13)8-20)17-21-18(29-22-17)11-7-12(23(24)25)15(27-2)16(28-3)14(11)19/h4-7H,1-3H3 |
| InChIKey | VZDBBVRLHWOHPU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 133.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|